C16H24Si — CID 102464112
[(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane (PubChem CID 102464112) has the molecular formula C16H24Si and a molecular weight of 244.45 g/mol. Its IUPAC name is [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 102464112 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane |
| SMILES | C=C(/C=C\C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24Si/c1-14(12-13-16(2,3)4)17(5,6)15-10-8-7-9-11-15/h7-13H,1H2,2-6H3/b13-12- |
| InChIKey | NOAUSICRPNEIHE-SEYXRHQNSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|