About [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane
[(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane (PubChem CID 102464112) has the molecular formula C16H24Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane |
| PubChem CID | 102464112 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane |
| SMILES | C=C(/C=C\C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24Si/c1-14(12-13-16(2,3)4)17(5,6)15-10-8-7-9-11-15/h7-13H,1H2,2-6H3/b13-12- |
| InChIKey | NOAUSICRPNEIHE-SEYXRHQNSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane?
The IUPAC name of [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane (CID 102464112) is [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane.
What is the SMILES notation for [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane?
The canonical SMILES for [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane is C=C(/C=C\C(C)(C)C)[Si](C)(C)c1ccccc1.
What is the InChIKey of [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane?
The InChIKey is NOAUSICRPNEIHE-SEYXRHQNSA-N. The full InChI is InChI=1S/C16H24Si/c1-14(12-13-16(2,3)4)17(5,6)15-10-8-7-9-11-15/h7-13H,1H2,2-6H3/b13-12-.
What are the key properties of [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane?
[(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane has a molecular weight of 244.45 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-5,5-dimethylhexa-1,3-dien-2-yl]-dimethyl-phenylsilane is sourced from PubChem (CID 102464112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).