C17H22O2Si — CID 166018796
[tert-butyl(diphenyl)silyl]methanediol (PubChem CID 166018796) has the molecular formula C17H22O2Si and a molecular weight of 286.45 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl]methanediol.
| Compound Name | [tert-butyl(diphenyl)silyl]methanediol |
|---|---|
| PubChem CID | 166018796 |
| Molecular Formula | C17H22O2Si |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [tert-butyl(diphenyl)silyl]methanediol |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C(O)O |
| InChI | InChI=1S/C17H22O2Si/c1-17(2,3)20(16(18)19,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16,18-19H,1-3H3 |
| InChIKey | BHOLUYKSPVJBEH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|