C29H36OSi — CID 134904760
(E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-4-methyl-1-phenylhex-4-en-1-ol (PubChem CID 134904760) has the molecular formula C29H36OSi and a molecular weight of 428.69 g/mol. Its IUPAC name is (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-4-methyl-1-phenylhex-4-en-1-ol.
| Compound Name | (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-4-methyl-1-phenylhex-4-en-1-ol |
|---|---|
| PubChem CID | 134904760 |
| Molecular Formula | C29H36OSi |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-4-methyl-1-phenylhex-4-en-1-ol |
| SMILES | C/C=C(\C)[C@@H](C[C@@H](O)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36OSi/c1-6-23(2)28(22-27(30)24-16-10-7-11-17-24)31(29(3,4)5,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h6-21,27-28,30H,22H2,1-5H3/b23-6+/t27-,28-/m1/s1 |
| InChIKey | KDLCQHXDGKYFKY-YYSVGBMSSA-N |
| XLogP | 6.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|