C28H34OSi — CID 11058768
(E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylhex-4-en-1-ol (PubChem CID 11058768) has the molecular formula C28H34OSi and a molecular weight of 414.67 g/mol. Its IUPAC name is (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylhex-4-en-1-ol.
| Compound Name | (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylhex-4-en-1-ol |
|---|---|
| PubChem CID | 11058768 |
| Molecular Formula | C28H34OSi |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (E,1R,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylhex-4-en-1-ol |
| SMILES | C/C=C/[C@H](C[C@@H](O)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34OSi/c1-5-15-26(22-27(29)23-16-9-6-10-17-23)30(28(2,3)4,24-18-11-7-12-19-24)25-20-13-8-14-21-25/h5-21,26-27,29H,22H2,1-4H3/b15-5+/t26-,27-/m1/s1 |
| InChIKey | CGMNBWVDNYCVDG-RMGZSPTMSA-N |
| XLogP | 6.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|