C22H28O3Si — CID 10361701
[(E,3S)-3-[dimethyl(phenyl)silyl]hex-4-enyl] 2-hydroxy-2-phenylacetate (PubChem CID 10361701) has the molecular formula C22H28O3Si and a molecular weight of 368.55 g/mol. Its IUPAC name is [(E,3S)-3-[dimethyl(phenyl)silyl]hex-4-enyl] 2-hydroxy-2-phenylacetate.
| Compound Name | [(E,3S)-3-[dimethyl(phenyl)silyl]hex-4-enyl] 2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 10361701 |
| Molecular Formula | C22H28O3Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(E,3S)-3-[dimethyl(phenyl)silyl]hex-4-enyl] 2-hydroxy-2-phenylacetate |
| SMILES | C/C=C/C(CCOC(=O)C(O)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H28O3Si/c1-4-11-19(26(2,3)20-14-9-6-10-15-20)16-17-25-22(24)21(23)18-12-7-5-8-13-18/h4-15,19,21,23H,16-17H2,1-3H3/b11-4+ |
| InChIKey | DIBGFXMGDTXDLH-NYYWCZLTSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|