C27H32OSi — CID 135746136
(1S,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylpent-4-en-1-ol (PubChem CID 135746136) has the molecular formula C27H32OSi and a molecular weight of 400.64 g/mol. Its IUPAC name is (1S,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylpent-4-en-1-ol.
| Compound Name | (1S,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 135746136 |
| Molecular Formula | C27H32OSi |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1S,3R)-3-[tert-butyl(diphenyl)silyl]-1-phenylpent-4-en-1-ol |
| SMILES | C=C[C@@H](C[C@H](O)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H32OSi/c1-5-23(21-26(28)22-15-9-6-10-16-22)29(27(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h5-20,23,26,28H,1,21H2,2-4H3/t23-,26-/m0/s1 |
| InChIKey | ITIFLYPFPVGRKH-OZXSUGGESA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|