C21H26OSi — CID 11834255
(2S,4R)-4-[diphenyl(prop-2-enyl)silyl]hex-5-en-2-ol (PubChem CID 11834255) has the molecular formula C21H26OSi and a molecular weight of 322.52 g/mol. Its IUPAC name is (2S,4R)-4-[diphenyl(prop-2-enyl)silyl]hex-5-en-2-ol.
| Compound Name | (2S,4R)-4-[diphenyl(prop-2-enyl)silyl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 11834255 |
| Molecular Formula | C21H26OSi |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2S,4R)-4-[diphenyl(prop-2-enyl)silyl]hex-5-en-2-ol |
| SMILES | C=CC[Si](c1ccccc1)(c1ccccc1)[C@@H](C=C)C[C@H](C)O |
| InChI | InChI=1S/C21H26OSi/c1-4-16-23(19(5-2)17-18(3)22,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h4-15,18-19,22H,1-2,16-17H2,3H3/t18-,19-/m0/s1 |
| InChIKey | AGYGTZPYLJTSRO-OALUTQOASA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|