C16H24OSi — CID 162415777
(1E,3S,4S)-1-[dimethyl(phenyl)silyl]-2,4-dimethylhexa-1,5-dien-3-ol (PubChem CID 162415777) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is (1E,3S,4S)-1-[dimethyl(phenyl)silyl]-2,4-dimethylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3S,4S)-1-[dimethyl(phenyl)silyl]-2,4-dimethylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 162415777 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (1E,3S,4S)-1-[dimethyl(phenyl)silyl]-2,4-dimethylhexa-1,5-dien-3-ol |
| SMILES | C=C[C@H](C)[C@H](O)/C(C)=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24OSi/c1-6-13(2)16(17)14(3)12-18(4,5)15-10-8-7-9-11-15/h6-13,16-17H,1H2,2-5H3/b14-12+/t13-,16-/m0/s1 |
| InChIKey | MOUYIVHDFQVFBP-XRUBZXBOSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|