C14H22OSi — CID 102406326
(2R,3R)-2-[dimethyl(phenyl)silyl]-3-methylpent-4-en-2-ol (PubChem CID 102406326) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is (2R,3R)-2-[dimethyl(phenyl)silyl]-3-methylpent-4-en-2-ol.
| Compound Name | (2R,3R)-2-[dimethyl(phenyl)silyl]-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 102406326 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2R,3R)-2-[dimethyl(phenyl)silyl]-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@@H](C)[C@](C)(O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H22OSi/c1-6-12(2)14(3,15)16(4,5)13-10-8-7-9-11-13/h6-12,15H,1H2,2-5H3/t12-,14-/m1/s1 |
| InChIKey | JRASBQDYIZIUMJ-TZMCWYRMSA-N |
| XLogP | 2.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|