C16H24OSi — CID 166442245
2-[dimethyl(phenyl)silyl]-5,5-dimethylhex-3-yn-2-ol (PubChem CID 166442245) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is 2-[dimethyl(phenyl)silyl]-5,5-dimethylhex-3-yn-2-ol.
| Compound Name | 2-[dimethyl(phenyl)silyl]-5,5-dimethylhex-3-yn-2-ol |
|---|---|
| PubChem CID | 166442245 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[dimethyl(phenyl)silyl]-5,5-dimethylhex-3-yn-2-ol |
| SMILES | CC(C)(C)C#CC(C)(O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24OSi/c1-15(2,3)12-13-16(4,17)18(5,6)14-10-8-7-9-11-14/h7-11,17H,1-6H3 |
| InChIKey | SXRRELKPVVRIIJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|