C15H24OSi — CID 154723365
(E,3S)-3-[dimethyl(phenyl)silyl]-4-methylhex-4-en-3-ol (PubChem CID 154723365) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is (E,3S)-3-[dimethyl(phenyl)silyl]-4-methylhex-4-en-3-ol.
| Compound Name | (E,3S)-3-[dimethyl(phenyl)silyl]-4-methylhex-4-en-3-ol |
|---|---|
| PubChem CID | 154723365 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (E,3S)-3-[dimethyl(phenyl)silyl]-4-methylhex-4-en-3-ol |
| SMILES | C/C=C(\C)[C@](O)(CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H24OSi/c1-6-13(3)15(16,7-2)17(4,5)14-11-9-8-10-12-14/h6,8-12,16H,7H2,1-5H3/b13-6+/t15-/m0/s1 |
| InChIKey | SFQGMCLUKIWCBG-NNSJBKGDSA-N |
| XLogP | 3.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|