C27H30O2Si — CID 132535500
(E,2S)-2-ethyl-3-methyl-2-[methyl(diphenyl)silyl]oxy-1-phenylpent-3-en-1-one (PubChem CID 132535500) has the molecular formula C27H30O2Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (E,2S)-2-ethyl-3-methyl-2-[methyl(diphenyl)silyl]oxy-1-phenylpent-3-en-1-one.
| Compound Name | (E,2S)-2-ethyl-3-methyl-2-[methyl(diphenyl)silyl]oxy-1-phenylpent-3-en-1-one |
|---|---|
| PubChem CID | 132535500 |
| Molecular Formula | C27H30O2Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (E,2S)-2-ethyl-3-methyl-2-[methyl(diphenyl)silyl]oxy-1-phenylpent-3-en-1-one |
| SMILES | C/C=C(\C)[C@](CC)(O[Si](C)(c1ccccc1)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30O2Si/c1-5-22(3)27(6-2,26(28)23-16-10-7-11-17-23)29-30(4,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h5,7-21H,6H2,1-4H3/b22-5+/t27-/m0/s1 |
| InChIKey | PACUVTUUNHVULC-TZYUGAOFSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|