C24H34OSi — CID 134951438
(E)-2,5,7-trimethyl-4-[methyl(diphenyl)silyl]oct-5-en-4-ol (PubChem CID 134951438) has the molecular formula C24H34OSi and a molecular weight of 366.62 g/mol. Its IUPAC name is (E)-2,5,7-trimethyl-4-[methyl(diphenyl)silyl]oct-5-en-4-ol.
| Compound Name | (E)-2,5,7-trimethyl-4-[methyl(diphenyl)silyl]oct-5-en-4-ol |
|---|---|
| PubChem CID | 134951438 |
| Molecular Formula | C24H34OSi |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (E)-2,5,7-trimethyl-4-[methyl(diphenyl)silyl]oct-5-en-4-ol |
| SMILES | C/C(=C\C(C)C)C(O)(CC(C)C)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H34OSi/c1-19(2)17-21(5)24(25,18-20(3)4)26(6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-17,19-20,25H,18H2,1-6H3/b21-17+ |
| InChIKey | JHFWGTPIVRAGGB-HEHNFIMWSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|