C22H36OSi — CID 154710158
(E,3S)-1-cyclohexyl-3-[dimethyl(phenyl)silyl]-2,5-dimethylhex-1-en-3-ol (PubChem CID 154710158) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is (E,3S)-1-cyclohexyl-3-[dimethyl(phenyl)silyl]-2,5-dimethylhex-1-en-3-ol.
| Compound Name | (E,3S)-1-cyclohexyl-3-[dimethyl(phenyl)silyl]-2,5-dimethylhex-1-en-3-ol |
|---|---|
| PubChem CID | 154710158 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (E,3S)-1-cyclohexyl-3-[dimethyl(phenyl)silyl]-2,5-dimethylhex-1-en-3-ol |
| SMILES | C/C(=C\C1CCCCC1)[C@](O)(CC(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H36OSi/c1-18(2)17-22(23,19(3)16-20-12-8-6-9-13-20)24(4,5)21-14-10-7-11-15-21/h7,10-11,14-16,18,20,23H,6,8-9,12-13,17H2,1-5H3/b19-16+/t22-/m0/s1 |
| InChIKey | ZGSCMLLAJWRKMB-JHNUBAFKSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|