C18H24 — CID 177407839
[(2E,4Z)-5-cyclohexylhexa-2,4-dien-2-yl]benzene (PubChem CID 177407839) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is [(2E,4Z)-5-cyclohexylhexa-2,4-dien-2-yl]benzene.
| Compound Name | [(2E,4Z)-5-cyclohexylhexa-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 177407839 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | [(2E,4Z)-5-cyclohexylhexa-2,4-dien-2-yl]benzene |
| SMILES | C/C(=C/C=C(\C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H24/c1-15(17-9-5-3-6-10-17)13-14-16(2)18-11-7-4-8-12-18/h3,5-6,9-10,13-14,18H,4,7-8,11-12H2,1-2H3/b15-13+,16-14- |
| InChIKey | UWEYVWFLGUVRFP-ZNOBWPMYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|