C13H20O — CID 88877979
(3E,5E)-6-cyclohexylhepta-1,3,5-trien-3-ol (PubChem CID 88877979) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3E,5E)-6-cyclohexylhepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-6-cyclohexylhepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 88877979 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3E,5E)-6-cyclohexylhepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)C1CCCCC1 |
| InChI | InChI=1S/C13H20O/c1-3-13(14)10-9-11(2)12-7-5-4-6-8-12/h3,9-10,12,14H,1,4-8H2,2H3/b11-9+,13-10+ |
| InChIKey | MDJKFYVJZGQVMN-HOJJKJLFSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|