C15H26 — CID 155693272
ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexane (PubChem CID 155693272) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexane.
| Compound Name | ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexane |
|---|---|
| PubChem CID | 155693272 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethane;[(3E)-4-methylhexa-1,3,5-trien-3-yl]cyclohexane |
| SMILES | C=C/C(C)=C(\C=C)C1CCCCC1.CC |
| InChI | InChI=1S/C13H20.C2H6/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;1-2/h4-5,12H,1-2,6-10H2,3H3;1-2H3/b13-11+; |
| InChIKey | JYSMCKOLDULRHY-BNSHTTSQSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|