About 3-methylbuta-1,3-dien-2-ylcyclohexane
3-methylbuta-1,3-dien-2-ylcyclohexane (PubChem CID 123355728) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is 3-methylbuta-1,3-dien-2-ylcyclohexane.
Molecular Properties
| Compound Name | 3-methylbuta-1,3-dien-2-ylcyclohexane |
| PubChem CID | 123355728 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 3-methylbuta-1,3-dien-2-ylcyclohexane |
| SMILES | C=C(C)C(=C)C1CCCCC1 |
| InChI | InChI=1S/C11H18/c1-9(2)10(3)11-7-5-4-6-8-11/h11H,1,3-8H2,2H3 |
| InChIKey | XUCCRCNULOYDGN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbuta-1,3-dien-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbuta-1,3-dien-2-ylcyclohexane?
The IUPAC name of 3-methylbuta-1,3-dien-2-ylcyclohexane (CID 123355728) is 3-methylbuta-1,3-dien-2-ylcyclohexane.
What is the SMILES notation for 3-methylbuta-1,3-dien-2-ylcyclohexane?
The canonical SMILES for 3-methylbuta-1,3-dien-2-ylcyclohexane is C=C(C)C(=C)C1CCCCC1.
What is the InChIKey of 3-methylbuta-1,3-dien-2-ylcyclohexane?
The InChIKey is XUCCRCNULOYDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-9(2)10(3)11-7-5-4-6-8-11/h11H,1,3-8H2,2H3.
What are the key properties of 3-methylbuta-1,3-dien-2-ylcyclohexane?
3-methylbuta-1,3-dien-2-ylcyclohexane has a molecular weight of 150.26 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbuta-1,3-dien-2-ylcyclohexane is sourced from PubChem (CID 123355728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).