About 1-cyclohexylethanethione
1-cyclohexylethanethione (PubChem CID 13294348) has the molecular formula C8H14S
and a molecular weight of 142.27 g/mol. Its IUPAC name is 1-cyclohexylethanethione.
Molecular Properties
| Compound Name | 1-cyclohexylethanethione |
| PubChem CID | 13294348 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 1-cyclohexylethanethione |
| SMILES | CC(=S)C1CCCCC1 |
| InChI | InChI=1S/C8H14S/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| InChIKey | FIWWESNFPXEQMT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanethione?
The IUPAC name of 1-cyclohexylethanethione (CID 13294348) is 1-cyclohexylethanethione.
What is the SMILES notation for 1-cyclohexylethanethione?
The canonical SMILES for 1-cyclohexylethanethione is CC(=S)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethanethione?
The InChIKey is FIWWESNFPXEQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3.
What are the key properties of 1-cyclohexylethanethione?
1-cyclohexylethanethione has a molecular weight of 142.27 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanethione is sourced from PubChem (CID 13294348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).