About 1-cyclooctylethanimine
1-cyclooctylethanimine (PubChem CID 142132470) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 1-cyclooctylethanimine.
Molecular Properties
| Compound Name | 1-cyclooctylethanimine |
| PubChem CID | 142132470 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1-cyclooctylethanimine |
| SMILES | [H]/N=C(\C)C1CCCCCCC1 |
| InChI | InChI=1S/C10H19N/c1-9(11)10-7-5-3-2-4-6-8-10/h10-11H,2-8H2,1H3/b11-9+ |
| InChIKey | ZZAVZRVQRCXISV-PKNBQFBNSA-N |
| XLogP | 3.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclooctylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctylethanimine?
The IUPAC name of 1-cyclooctylethanimine (CID 142132470) is 1-cyclooctylethanimine.
What is the SMILES notation for 1-cyclooctylethanimine?
The canonical SMILES for 1-cyclooctylethanimine is [H]/N=C(\C)C1CCCCCCC1.
What is the InChIKey of 1-cyclooctylethanimine?
The InChIKey is ZZAVZRVQRCXISV-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H19N/c1-9(11)10-7-5-3-2-4-6-8-10/h10-11H,2-8H2,1H3/b11-9+.
What are the key properties of 1-cyclooctylethanimine?
1-cyclooctylethanimine has a molecular weight of 153.27 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctylethanimine is sourced from PubChem (CID 142132470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).