About cycloundecanecarbonyl(methyl)azanide;rhenium
cycloundecanecarbonyl(methyl)azanide;rhenium (PubChem CID 163449184) has the molecular formula C13H24NORe-
and a molecular weight of 396.55 g/mol. Its IUPAC name is cycloundecanecarbonyl(methyl)azanide;rhenium.
Molecular Properties
| Compound Name | cycloundecanecarbonyl(methyl)azanide;rhenium |
| PubChem CID | 163449184 |
| Molecular Formula | C13H24NORe- |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | cycloundecanecarbonyl(methyl)azanide;rhenium |
| SMILES | C[N-]C(=O)C1CCCCCCCCCC1.[Re] |
| InChI | InChI=1S/C13H25NO.Re/c1-14-13(15)12-10-8-6-4-2-3-5-7-9-11-12;/h12H,2-11H2,1H3,(H,14,15);/p-1 |
| InChIKey | PHYLSLFOCMUAIM-UHFFFAOYSA-M |
| XLogP | 4.04 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cycloundecanecarbonyl(methyl)azanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloundecanecarbonyl(methyl)azanide;rhenium?
The IUPAC name of cycloundecanecarbonyl(methyl)azanide;rhenium (CID 163449184) is cycloundecanecarbonyl(methyl)azanide;rhenium.
What is the SMILES notation for cycloundecanecarbonyl(methyl)azanide;rhenium?
The canonical SMILES for cycloundecanecarbonyl(methyl)azanide;rhenium is C[N-]C(=O)C1CCCCCCCCCC1.[Re].
What is the InChIKey of cycloundecanecarbonyl(methyl)azanide;rhenium?
The InChIKey is PHYLSLFOCMUAIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H25NO.Re/c1-14-13(15)12-10-8-6-4-2-3-5-7-9-11-12;/h12H,2-11H2,1H3,(H,14,15);/p-1.
What are the key properties of cycloundecanecarbonyl(methyl)azanide;rhenium?
cycloundecanecarbonyl(methyl)azanide;rhenium has a molecular weight of 396.55 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cycloundecanecarbonyl(methyl)azanide;rhenium is sourced from PubChem (CID 163449184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).