About dicyclohexylmethanone;formaldehyde
dicyclohexylmethanone;formaldehyde (PubChem CID 175300134) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is dicyclohexylmethanone;formaldehyde.
Molecular Properties
| Compound Name | dicyclohexylmethanone;formaldehyde |
| PubChem CID | 175300134 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | dicyclohexylmethanone;formaldehyde |
| SMILES | C=O.O=C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H22O.CH2O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h11-12H,1-10H2;1H2 |
| InChIKey | WBVNIYKONQKSHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dicyclohexylmethanone;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylmethanone;formaldehyde?
The IUPAC name of dicyclohexylmethanone;formaldehyde (CID 175300134) is dicyclohexylmethanone;formaldehyde.
What is the SMILES notation for dicyclohexylmethanone;formaldehyde?
The canonical SMILES for dicyclohexylmethanone;formaldehyde is C=O.O=C(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylmethanone;formaldehyde?
The InChIKey is WBVNIYKONQKSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O.CH2O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h11-12H,1-10H2;1H2.
What are the key properties of dicyclohexylmethanone;formaldehyde?
dicyclohexylmethanone;formaldehyde has a molecular weight of 224.34 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylmethanone;formaldehyde is sourced from PubChem (CID 175300134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).