About cycloheptanecarboxylate;thallium(1+)
cycloheptanecarboxylate;thallium(1+) (PubChem CID 22604442) has the molecular formula C8H13O2Tl
and a molecular weight of 345.57 g/mol. Its IUPAC name is cycloheptanecarboxylate;thallium(1+).
Molecular Properties
| Compound Name | cycloheptanecarboxylate;thallium(1+) |
| PubChem CID | 22604442 |
| Molecular Formula | C8H13O2Tl |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | cycloheptanecarboxylate;thallium(1+) |
| SMILES | O=C([O-])C1CCCCCC1.[Tl+] |
| InChI | InChI=1S/C8H14O2.Tl/c9-8(10)7-5-3-1-2-4-6-7;/h7H,1-6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | QQMFQWXVDYMRIW-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloheptanecarboxylate;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptanecarboxylate;thallium(1+)?
The IUPAC name of cycloheptanecarboxylate;thallium(1+) (CID 22604442) is cycloheptanecarboxylate;thallium(1+).
What is the SMILES notation for cycloheptanecarboxylate;thallium(1+)?
The canonical SMILES for cycloheptanecarboxylate;thallium(1+) is O=C([O-])C1CCCCCC1.[Tl+].
What is the InChIKey of cycloheptanecarboxylate;thallium(1+)?
The InChIKey is QQMFQWXVDYMRIW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O2.Tl/c9-8(10)7-5-3-1-2-4-6-7;/h7H,1-6H2,(H,9,10);/q;+1/p-1.
What are the key properties of cycloheptanecarboxylate;thallium(1+)?
cycloheptanecarboxylate;thallium(1+) has a molecular weight of 345.57 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptanecarboxylate;thallium(1+) is sourced from PubChem (CID 22604442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).