About azanium cyclobutanecarboxylate
azanium cyclobutanecarboxylate (PubChem CID 160775595) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is azanium cyclobutanecarboxylate.
Molecular Properties
| Compound Name | azanium cyclobutanecarboxylate |
| PubChem CID | 160775595 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | azanium cyclobutanecarboxylate |
| SMILES | O=C([O-])C1CCC1.[NH4+] |
| InChI | InChI=1S/C5H8O2.H3N/c6-5(7)4-2-1-3-4;/h4H,1-3H2,(H,6,7);1H3 |
| InChIKey | RZXANPGSRHLWRV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium cyclobutanecarboxylate?
The IUPAC name of azanium cyclobutanecarboxylate (CID 160775595) is azanium cyclobutanecarboxylate.
What is the SMILES notation for azanium cyclobutanecarboxylate?
The canonical SMILES for azanium cyclobutanecarboxylate is O=C([O-])C1CCC1.[NH4+].
What is the InChIKey of azanium cyclobutanecarboxylate?
The InChIKey is RZXANPGSRHLWRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.H3N/c6-5(7)4-2-1-3-4;/h4H,1-3H2,(H,6,7);1H3.
What are the key properties of azanium cyclobutanecarboxylate?
azanium cyclobutanecarboxylate has a molecular weight of 117.15 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium cyclobutanecarboxylate is sourced from PubChem (CID 160775595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).