C8H10CaO4 — CID 140879538
calcium cyclohexane-1,3-dicarboxylate (PubChem CID 140879538) has the molecular formula C8H10CaO4 and a molecular weight of 210.24 g/mol. Its IUPAC name is calcium cyclohexane-1,3-dicarboxylate.
| Compound Name | calcium cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140879538 |
| Molecular Formula | C8H10CaO4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | calcium cyclohexane-1,3-dicarboxylate |
| SMILES | O=C([O-])C1CCCC(C(=O)[O-])C1.[Ca+2] |
| InChI | InChI=1S/C8H12O4.Ca/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h5-6H,1-4H2,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | NBFJJSGEFDBLFR-UHFFFAOYSA-L |
| XLogP | -2.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |