C6H11NO2 — CID 11882159
cis-(1S,3R)-3-azaniumylcyclopentane-1-carboxylate (PubChem CID 11882159) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is cis-(1S,3R)-3-azaniumylcyclopentane-1-carboxylate.
| Compound Name | cis-(1S,3R)-3-azaniumylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11882159 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | cis-(1S,3R)-3-azaniumylcyclopentane-1-carboxylate |
| SMILES | [NH3+][C@@H]1CC[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | MLLSSTJTARJLHK-CRCLSJGQSA-N |
| XLogP | -1.85 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |