About cyclohexylazanium;carbonate
cyclohexylazanium;carbonate (PubChem CID 15793122) has the molecular formula C13H28N2O3
and a molecular weight of 260.38 g/mol. Its IUPAC name is cyclohexylazanium;carbonate.
Molecular Properties
| Compound Name | cyclohexylazanium;carbonate |
| PubChem CID | 15793122 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | cyclohexylazanium;carbonate |
| SMILES | O=C([O-])[O-].[NH3+]C1CCCCC1.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/2C6H13N.CH2O3/c2*7-6-4-2-1-3-5-6;2-1(3)4/h2*6H,1-5,7H2;(H2,2,3,4) |
| InChIKey | MYDIEYHHUXTWFX-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexylazanium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylazanium;carbonate?
The IUPAC name of cyclohexylazanium;carbonate (CID 15793122) is cyclohexylazanium;carbonate.
What is the SMILES notation for cyclohexylazanium;carbonate?
The canonical SMILES for cyclohexylazanium;carbonate is O=C([O-])[O-].[NH3+]C1CCCCC1.[NH3+]C1CCCCC1.
What is the InChIKey of cyclohexylazanium;carbonate?
The InChIKey is MYDIEYHHUXTWFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13N.CH2O3/c2*7-6-4-2-1-3-5-6;2-1(3)4/h2*6H,1-5,7H2;(H2,2,3,4).
What are the key properties of cyclohexylazanium;carbonate?
cyclohexylazanium;carbonate has a molecular weight of 260.38 g/mol, XLogP of -1.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylazanium;carbonate is sourced from PubChem (CID 15793122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).