About calcium;cyclohexane;carbonate
calcium;cyclohexane;carbonate (PubChem CID 163512778) has the molecular formula C7H12CaO3
and a molecular weight of 184.25 g/mol. Its IUPAC name is calcium;cyclohexane;carbonate.
Molecular Properties
| Compound Name | calcium;cyclohexane;carbonate |
| PubChem CID | 163512778 |
| Molecular Formula | C7H12CaO3 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | calcium;cyclohexane;carbonate |
| SMILES | C1CCCCC1.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C6H12.CH2O3.Ca/c1-2-4-6-5-3-1;2-1(3)4;/h1-6H2;(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | DEBZQLNMSWJVOM-UHFFFAOYSA-L |
| XLogP | -0.49 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;cyclohexane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;cyclohexane;carbonate?
The IUPAC name of calcium;cyclohexane;carbonate (CID 163512778) is calcium;cyclohexane;carbonate.
What is the SMILES notation for calcium;cyclohexane;carbonate?
The canonical SMILES for calcium;cyclohexane;carbonate is C1CCCCC1.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;cyclohexane;carbonate?
The InChIKey is DEBZQLNMSWJVOM-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12.CH2O3.Ca/c1-2-4-6-5-3-1;2-1(3)4;/h1-6H2;(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;cyclohexane;carbonate?
calcium;cyclohexane;carbonate has a molecular weight of 184.25 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;cyclohexane;carbonate is sourced from PubChem (CID 163512778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).