C26H53N4O3P — CID 139084006
N-bis(cyclohexylamino)phosphorylcyclohexanamine;cyclohexylazanium;acetate (PubChem CID 139084006) has the molecular formula C26H53N4O3P and a molecular weight of 500.71 g/mol. Its IUPAC name is N-bis(cyclohexylamino)phosphorylcyclohexanamine;cyclohexylazanium;acetate.
| Compound Name | N-bis(cyclohexylamino)phosphorylcyclohexanamine;cyclohexylazanium;acetate |
|---|---|
| PubChem CID | 139084006 |
| Molecular Formula | C26H53N4O3P |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | N-bis(cyclohexylamino)phosphorylcyclohexanamine;cyclohexylazanium;acetate |
| SMILES | CC(=O)[O-].O=P(NC1CCCCC1)(NC1CCCCC1)NC1CCCCC1.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C18H36N3OP.C6H13N.C2H4O2/c22-23(19-16-10-4-1-5-11-16,20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;7-6-4-2-1-3-5-6;1-2(3)4/h16-18H,1-15H2,(H3,19,20,21,22);6H,1-5,7H2;1H3,(H,3,4) |
| InChIKey | MXBLRRBCKRYBOB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|