About sodium;(cyclohexylamino) acetate;hydride
sodium;(cyclohexylamino) acetate;hydride (PubChem CID 174740785) has the molecular formula C8H16NNaO2
and a molecular weight of 181.21 g/mol. Its IUPAC name is sodium;(cyclohexylamino) acetate;hydride.
Molecular Properties
| Compound Name | sodium;(cyclohexylamino) acetate;hydride |
| PubChem CID | 174740785 |
| Molecular Formula | C8H16NNaO2 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | sodium;(cyclohexylamino) acetate;hydride |
| SMILES | CC(=O)ONC1CCCCC1.[H-].[Na+] |
| InChI | InChI=1S/C8H15NO2.Na.H/c1-7(10)11-9-8-5-3-2-4-6-8;;/h8-9H,2-6H2,1H3;;/q;+1;-1 |
| InChIKey | BYAWSHADHGVWRQ-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;(cyclohexylamino) acetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(cyclohexylamino) acetate;hydride?
The IUPAC name of sodium;(cyclohexylamino) acetate;hydride (CID 174740785) is sodium;(cyclohexylamino) acetate;hydride.
What is the SMILES notation for sodium;(cyclohexylamino) acetate;hydride?
The canonical SMILES for sodium;(cyclohexylamino) acetate;hydride is CC(=O)ONC1CCCCC1.[H-].[Na+].
What is the InChIKey of sodium;(cyclohexylamino) acetate;hydride?
The InChIKey is BYAWSHADHGVWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.Na.H/c1-7(10)11-9-8-5-3-2-4-6-8;;/h8-9H,2-6H2,1H3;;/q;+1;-1.
What are the key properties of sodium;(cyclohexylamino) acetate;hydride?
sodium;(cyclohexylamino) acetate;hydride has a molecular weight of 181.21 g/mol, XLogP of -1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(cyclohexylamino) acetate;hydride is sourced from PubChem (CID 174740785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).