C11H23NO3 — CID 174795169
(cyclohexylamino) 2,2-dimethylpropanoate;hydrate (PubChem CID 174795169) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (cyclohexylamino) 2,2-dimethylpropanoate;hydrate.
| Compound Name | (cyclohexylamino) 2,2-dimethylpropanoate;hydrate |
|---|---|
| PubChem CID | 174795169 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (cyclohexylamino) 2,2-dimethylpropanoate;hydrate |
| SMILES | CC(C)(C)C(=O)ONC1CCCCC1.O |
| InChI | InChI=1S/C11H21NO2.H2O/c1-11(2,3)10(13)14-12-9-7-5-4-6-8-9;/h9,12H,4-8H2,1-3H3;1H2 |
| InChIKey | RLEBKKNBURVYKX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|