About cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane
cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane (PubChem CID 86741453) has the molecular formula C11H27N2O3P
and a molecular weight of 266.32 g/mol. Its IUPAC name is cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane.
Molecular Properties
| Compound Name | cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane |
| PubChem CID | 86741453 |
| Molecular Formula | C11H27N2O3P |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane |
| SMILES | CP(=O)([O-])[O-].[NH3+]C1CCCC1.[NH3+]C1CCCC1 |
| InChI | InChI=1S/2C5H11N.CH5O3P/c2*6-5-3-1-2-4-5;1-5(2,3)4/h2*5H,1-4,6H2;1H3,(H2,2,3,4) |
| InChIKey | XRIWPCKIKNZSIY-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane?
The IUPAC name of cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane (CID 86741453) is cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane.
What is the SMILES notation for cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane?
The canonical SMILES for cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane is CP(=O)([O-])[O-].[NH3+]C1CCCC1.[NH3+]C1CCCC1.
What is the InChIKey of cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane?
The InChIKey is XRIWPCKIKNZSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.CH5O3P/c2*6-5-3-1-2-4-5;1-5(2,3)4/h2*5H,1-4,6H2;1H3,(H2,2,3,4).
What are the key properties of cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane?
cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane has a molecular weight of 266.32 g/mol, XLogP of -1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylazanium;methyl-dioxido-oxo-λ5-phosphane is sourced from PubChem (CID 86741453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).