C11H24NO9P — CID 91873738
cyclohexylazanium;[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl] hydrogen phosphate (PubChem CID 91873738) has the molecular formula C11H24NO9P and a molecular weight of 345.29 g/mol. Its IUPAC name is cyclohexylazanium;[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl] hydrogen phosphate.
| Compound Name | cyclohexylazanium;[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl] hydrogen phosphate |
|---|---|
| PubChem CID | 91873738 |
| Molecular Formula | C11H24NO9P |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | cyclohexylazanium;[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl] hydrogen phosphate |
| SMILES | O=C(OP(=O)([O-])O)[C@H](O)[C@H](O)[C@H](O)CO.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C6H13N.C5H11O9P/c7-6-4-2-1-3-5-6;6-1-2(7)3(8)4(9)5(10)14-15(11,12)13/h6H,1-5,7H2;2-4,6-9H,1H2,(H2,11,12,13)/t;2-,3-,4-/m.1/s1 |
| InChIKey | DKIRPLJPKCSZHX-KPZUUGGMSA-N |
| XLogP | -3.37 |
| TPSA | 195.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|