C14H26N2O4 — CID 139677117
cyclohexylazanium;(2S)-1-(2-hydroxypropanoyl)pyrrolidine-2-carboxylate (PubChem CID 139677117) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is cyclohexylazanium;(2S)-1-(2-hydroxypropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | cyclohexylazanium;(2S)-1-(2-hydroxypropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139677117 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | cyclohexylazanium;(2S)-1-(2-hydroxypropanoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(O)C(=O)N1CCC[C@H]1C(=O)[O-].[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C8H13NO4.C6H13N/c1-5(10)7(11)9-4-2-3-6(9)8(12)13;7-6-4-2-1-3-5-6/h5-6,10H,2-4H2,1H3,(H,12,13);6H,1-5,7H2/t5?,6-;/m0./s1 |
| InChIKey | FAWUFSNSBDUZFN-PQAGPIFVSA-N |
| XLogP | -1.33 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |