C10H16NNaO3S — CID 88787958
sodium 1-(2-methyl-3-sulfanylpropanoyl)piperidine-2-carboxylate (PubChem CID 88787958) has the molecular formula C10H16NNaO3S and a molecular weight of 253.30 g/mol. Its IUPAC name is sodium 1-(2-methyl-3-sulfanylpropanoyl)piperidine-2-carboxylate.
| Compound Name | sodium 1-(2-methyl-3-sulfanylpropanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 88787958 |
| Molecular Formula | C10H16NNaO3S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | sodium 1-(2-methyl-3-sulfanylpropanoyl)piperidine-2-carboxylate |
| SMILES | CC(CS)C(=O)N1CCCCC1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H17NO3S.Na/c1-7(6-15)9(12)11-5-3-2-4-8(11)10(13)14;/h7-8,15H,2-6H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | WVQHWJLZDFFMRU-UHFFFAOYSA-M |
| XLogP | -3.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|