C9H17NOS2 — CID 167189729
2-methyl-1-(2-methylsulfanylpyrrolidin-1-yl)-3-sulfanylpropan-1-one (PubChem CID 167189729) has the molecular formula C9H17NOS2 and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylpyrrolidin-1-yl)-3-sulfanylpropan-1-one.
| Compound Name | 2-methyl-1-(2-methylsulfanylpyrrolidin-1-yl)-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 167189729 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylpyrrolidin-1-yl)-3-sulfanylpropan-1-one |
| SMILES | CSC1CCCN1C(=O)C(C)CS |
| InChI | InChI=1S/C9H17NOS2/c1-7(6-12)9(11)10-5-3-4-8(10)13-2/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | AALWRPGMWHHXTI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|