C9H15NO2S — CID 173434438
(2S)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carbaldehyde (PubChem CID 173434438) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (2S)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 173434438 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2S)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carbaldehyde |
| SMILES | CC(CS)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C9H15NO2S/c1-7(6-13)9(12)10-4-2-3-8(10)5-11/h5,7-8,13H,2-4,6H2,1H3/t7?,8-/m0/s1 |
| InChIKey | WOWMGOTYMKQMGS-MQWKRIRWSA-N |
| XLogP | 0.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|