C10H19N3O2 — CID 173376381
(2S)-1-[(2S)-2,5-diaminopentanoyl]pyrrolidine-2-carbaldehyde (PubChem CID 173376381) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2S)-1-[(2S)-2,5-diaminopentanoyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-[(2S)-2,5-diaminopentanoyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 173376381 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (2S)-1-[(2S)-2,5-diaminopentanoyl]pyrrolidine-2-carbaldehyde |
| SMILES | NCCC[C@H](N)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C10H19N3O2/c11-5-1-4-9(12)10(15)13-6-2-3-8(13)7-14/h7-9H,1-6,11-12H2/t8-,9-/m0/s1 |
| InChIKey | GVUQMCJJNRSTJI-IUCAKERBSA-N |
| XLogP | -0.76 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|