C13H26N2O — CID 103831675
(2S)-2-amino-1-(2,3-dimethylpiperidin-1-yl)hexan-1-one (PubChem CID 103831675) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (2S)-2-amino-1-(2,3-dimethylpiperidin-1-yl)hexan-1-one.
| Compound Name | (2S)-2-amino-1-(2,3-dimethylpiperidin-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 103831675 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (2S)-2-amino-1-(2,3-dimethylpiperidin-1-yl)hexan-1-one |
| SMILES | CCCC[C@H](N)C(=O)N1CCCC(C)C1C |
| InChI | InChI=1S/C13H26N2O/c1-4-5-8-12(14)13(16)15-9-6-7-10(2)11(15)3/h10-12H,4-9,14H2,1-3H3/t10?,11?,12-/m0/s1 |
| InChIKey | AYJCJERTDHOUBY-MCIGGMRASA-N |
| XLogP | 2.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |