C11H20BrNO — CID 62856002
2-bromo-1-(2,3-dimethylpiperidin-1-yl)butan-1-one (PubChem CID 62856002) has the molecular formula C11H20BrNO and a molecular weight of 262.19 g/mol. Its IUPAC name is 2-bromo-1-(2,3-dimethylpiperidin-1-yl)butan-1-one.
| Compound Name | 2-bromo-1-(2,3-dimethylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 62856002 |
| Molecular Formula | C11H20BrNO |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-bromo-1-(2,3-dimethylpiperidin-1-yl)butan-1-one |
| SMILES | CCC(Br)C(=O)N1CCCC(C)C1C |
| InChI | InChI=1S/C11H20BrNO/c1-4-10(12)11(14)13-7-5-6-8(2)9(13)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | AUCXKJDTUDYCDV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|