C8H14ClNO — CID 79886901
2,3-dimethylpiperidine-1-carbonyl chloride (PubChem CID 79886901) has the molecular formula C8H14ClNO and a molecular weight of 175.66 g/mol. Its IUPAC name is 2,3-dimethylpiperidine-1-carbonyl chloride.
| Compound Name | 2,3-dimethylpiperidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 79886901 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2,3-dimethylpiperidine-1-carbonyl chloride |
| SMILES | CC1CCCN(C(=O)Cl)C1C |
| InChI | InChI=1S/C8H14ClNO/c1-6-4-3-5-10(7(6)2)8(9)11/h6-7H,3-5H2,1-2H3 |
| InChIKey | LZOBJLYTOCNYAP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|