C10H19NO — CID 64591825
1-(2,3-dimethylpiperidin-1-yl)propan-1-one (PubChem CID 64591825) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2,3-dimethylpiperidin-1-yl)propan-1-one.
| Compound Name | 1-(2,3-dimethylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 64591825 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(2,3-dimethylpiperidin-1-yl)propan-1-one |
| SMILES | CCC(=O)N1CCCC(C)C1C |
| InChI | InChI=1S/C10H19NO/c1-4-10(12)11-7-5-6-8(2)9(11)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | RSADXDFKRPXFFS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |