About 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone
2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone (PubChem CID 130932525) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone |
| PubChem CID | 130932525 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CN)C1C |
| InChI | InChI=1S/C8H16N2O/c1-6-3-4-10(7(6)2)8(11)5-9/h6-7H,3-5,9H2,1-2H3 |
| InChIKey | SQGJNMNPLJUWFU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone?
The IUPAC name of 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone (CID 130932525) is 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone.
What is the SMILES notation for 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone?
The canonical SMILES for 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone is CC1CCN(C(=O)CN)C1C.
What is the InChIKey of 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone?
The InChIKey is SQGJNMNPLJUWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-6-3-4-10(7(6)2)8(11)5-9/h6-7H,3-5,9H2,1-2H3.
What are the key properties of 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone?
2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone has a molecular weight of 156.23 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,3-dimethylpyrrolidin-1-yl)ethanone is sourced from PubChem (CID 130932525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).