C9H15Cl2NO — CID 130667060
2,2-dichloro-1-(2,3-dimethylpyrrolidin-1-yl)propan-1-one (PubChem CID 130667060) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,3-dimethylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 2,2-dichloro-1-(2,3-dimethylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 130667060 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2,2-dichloro-1-(2,3-dimethylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC1CCN(C(=O)C(C)(Cl)Cl)C1C |
| InChI | InChI=1S/C9H15Cl2NO/c1-6-4-5-12(7(6)2)8(13)9(3,10)11/h6-7H,4-5H2,1-3H3 |
| InChIKey | YIFSDPMKQBSFCO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|