C10H17NO3 — CID 170767880
oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate (PubChem CID 170767880) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate.
| Compound Name | oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170767880 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC2COC2)C1C |
| InChI | InChI=1S/C10H17NO3/c1-7-3-4-11(8(7)2)10(12)14-9-5-13-6-9/h7-9H,3-6H2,1-2H3 |
| InChIKey | GCYUDECZBNARLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |