oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate

C10H17NO3 — CID 170767880

IUPACoxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate
SMILESCC1CCN(C(=O)OC2COC2)C1C
InChIInChI=1S/C10H17NO3/c1-7-3-4-11(8(7)2)10(12)14-9-5-13-6-9/h7-9H,3-6H2,1-2H3
InChIKeyGCYUDECZBNARLE-UHFFFAOYSA-N
MW199.25 g/mol
LogP1.25
Rot. Bonds1

About oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate

oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate (PubChem CID 170767880) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate.

Molecular Properties

Compound Nameoxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate
PubChem CID170767880
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Nameoxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate
SMILESCC1CCN(C(=O)OC2COC2)C1C
InChIInChI=1S/C10H17NO3/c1-7-3-4-11(8(7)2)10(12)14-9-5-13-6-9/h7-9H,3-6H2,1-2H3
InChIKeyGCYUDECZBNARLE-UHFFFAOYSA-N
XLogP1.25
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The IUPAC name of oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate (CID 170767880) is oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate.
What is the SMILES notation for oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The canonical SMILES for oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate is CC1CCN(C(=O)OC2COC2)C1C.
What is the InChIKey of oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The InChIKey is GCYUDECZBNARLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7-3-4-11(8(7)2)10(12)14-9-5-13-6-9/h7-9H,3-6H2,1-2H3.
What are the key properties of oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate is sourced from PubChem (CID 170767880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).