C12H19NO4 — CID 166272620
cyclopropyl (4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine-4-carboxylate (PubChem CID 166272620) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is cyclopropyl (4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine-4-carboxylate.
| Compound Name | cyclopropyl (4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 166272620 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | cyclopropyl (4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine-4-carboxylate |
| SMILES | CC1(C)CN(C(=O)OC2CC2)[C@@H]2COC[C@H]2O1 |
| InChI | InChI=1S/C12H19NO4/c1-12(2)7-13(11(14)16-8-3-4-8)9-5-15-6-10(9)17-12/h8-10H,3-7H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | FZXDSAVIQFPRNQ-NXEZZACHSA-N |
| XLogP | 1.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |