C12H18ClNO3 — CID 166247646
(Z)-1-[(4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazin-4-yl]-3-chlorobut-2-en-1-one (PubChem CID 166247646) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is (Z)-1-[(4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazin-4-yl]-3-chlorobut-2-en-1-one.
| Compound Name | (Z)-1-[(4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazin-4-yl]-3-chlorobut-2-en-1-one |
|---|---|
| PubChem CID | 166247646 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (Z)-1-[(4aR,7aS)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazin-4-yl]-3-chlorobut-2-en-1-one |
| SMILES | C/C(Cl)=C/C(=O)N1CC(C)(C)O[C@@H]2COC[C@H]21 |
| InChI | InChI=1S/C12H18ClNO3/c1-8(13)4-11(15)14-7-12(2,3)17-10-6-16-5-9(10)14/h4,9-10H,5-7H2,1-3H3/b8-4-/t9-,10-/m1/s1 |
| InChIKey | YZPRYJCVBTZTOJ-QPGUZKIZSA-N |
| XLogP | 1.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|