C11H19NO2 — CID 78976791
1-(2,2,6-trimethylmorpholin-4-yl)but-2-en-1-one (PubChem CID 78976791) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(2,2,6-trimethylmorpholin-4-yl)but-2-en-1-one.
| Compound Name | 1-(2,2,6-trimethylmorpholin-4-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 78976791 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(2,2,6-trimethylmorpholin-4-yl)but-2-en-1-one |
| SMILES | CC=CC(=O)N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-5-6-10(13)12-7-9(2)14-11(3,4)8-12/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | RTHLKRBWEHXTRR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|