About (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride
(1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride (PubChem CID 119748927) has the molecular formula C11H21ClN2O2
and a molecular weight of 248.75 g/mol. Its IUPAC name is (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride |
| PubChem CID | 119748927 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)C2(N)CC2)CC(C)(C)O1.Cl |
| InChI | InChI=1S/C11H20N2O2.ClH/c1-8-6-13(7-10(2,3)15-8)9(14)11(12)4-5-11;/h8H,4-7,12H2,1-3H3;1H |
| InChIKey | BYQPPOPCPZMPNX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride?
The IUPAC name of (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride (CID 119748927) is (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride.
What is the SMILES notation for (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride?
The canonical SMILES for (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride is CC1CN(C(=O)C2(N)CC2)CC(C)(C)O1.Cl.
What is the InChIKey of (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride?
The InChIKey is BYQPPOPCPZMPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2.ClH/c1-8-6-13(7-10(2,3)15-8)9(14)11(12)4-5-11;/h8H,4-7,12H2,1-3H3;1H.
What are the key properties of (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride?
(1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride has a molecular weight of 248.75 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclopropyl)-(2,2,6-trimethylmorpholin-4-yl)methanone;hydrochloride is sourced from PubChem (CID 119748927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).