C11H21ClN2O2 — CID 119751390
(1-aminocyclopropyl)-(2-ethyl-6-methylmorpholin-4-yl)methanone;hydrochloride (PubChem CID 119751390) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is (1-aminocyclopropyl)-(2-ethyl-6-methylmorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (1-aminocyclopropyl)-(2-ethyl-6-methylmorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119751390 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (1-aminocyclopropyl)-(2-ethyl-6-methylmorpholin-4-yl)methanone;hydrochloride |
| SMILES | CCC1CN(C(=O)C2(N)CC2)CC(C)O1.Cl |
| InChI | InChI=1S/C11H20N2O2.ClH/c1-3-9-7-13(6-8(2)15-9)10(14)11(12)4-5-11;/h8-9H,3-7,12H2,1-2H3;1H |
| InChIKey | ZGORJWYTZPVVRJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |